C33H57NO7 — CID 102336416
[3-octanoyloxy-2-(octanoyloxymethyl)-2-(pent-4-ynoylamino)propyl] octanoate (PubChem CID 102336416) has the molecular formula C33H57NO7 and a molecular weight of 579.82 g/mol. Its IUPAC name is [3-octanoyloxy-2-(octanoyloxymethyl)-2-(pent-4-ynoylamino)propyl] octanoate.
| Compound Name | [3-octanoyloxy-2-(octanoyloxymethyl)-2-(pent-4-ynoylamino)propyl] octanoate |
|---|---|
| PubChem CID | 102336416 |
| Molecular Formula | C33H57NO7 |
| Molecular Weight | 579.82 g/mol |
| Exact Mass | 579.41 |
| IUPAC Name | [3-octanoyloxy-2-(octanoyloxymethyl)-2-(pent-4-ynoylamino)propyl] octanoate |
| SMILES | C#CCCC(=O)NC(COC(=O)CCCCCCC)(COC(=O)CCCCCCC)COC(=O)CCCCCCC |
| InChI | InChI=1S/C33H57NO7/c1-5-9-13-16-19-23-30(36)39-26-33(34-29(35)22-12-8-4,27-40-31(37)24-20-17-14-10-6-2)28-41-32(38)25-21-18-15-11-7-3/h4H,5-7,9-28H2,1-3H3,(H,34,35) |
| InChIKey | VWLJGCBFTXOGCZ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.82 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|