About butanedihydrazide;hydrochloride
butanedihydrazide;hydrochloride (PubChem CID 54607274) has the molecular formula C4H11ClN4O2
and a molecular weight of 182.61 g/mol. Its IUPAC name is butanedihydrazide;hydrochloride.
Molecular Properties
| Compound Name | butanedihydrazide;hydrochloride |
| PubChem CID | 54607274 |
| Molecular Formula | C4H11ClN4O2 |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | butanedihydrazide;hydrochloride |
| SMILES | Cl.NNC(=O)CCC(=O)NN |
| InChI | InChI=1S/C4H10N4O2.ClH/c5-7-3(9)1-2-4(10)8-6;/h1-2,5-6H2,(H,7,9)(H,8,10);1H |
| InChIKey | ULWWCGOEHRGITN-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butanedihydrazide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedihydrazide;hydrochloride?
The IUPAC name of butanedihydrazide;hydrochloride (CID 54607274) is butanedihydrazide;hydrochloride.
What is the SMILES notation for butanedihydrazide;hydrochloride?
The canonical SMILES for butanedihydrazide;hydrochloride is Cl.NNC(=O)CCC(=O)NN.
What is the InChIKey of butanedihydrazide;hydrochloride?
The InChIKey is ULWWCGOEHRGITN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N4O2.ClH/c5-7-3(9)1-2-4(10)8-6;/h1-2,5-6H2,(H,7,9)(H,8,10);1H.
What are the key properties of butanedihydrazide;hydrochloride?
butanedihydrazide;hydrochloride has a molecular weight of 182.61 g/mol, XLogP of -1.83, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butanedihydrazide;hydrochloride is sourced from PubChem (CID 54607274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).