C8H18N6O3 — CID 18368507
pentane-1,3,5-tricarbohydrazide (PubChem CID 18368507) has the molecular formula C8H18N6O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is pentane-1,3,5-tricarbohydrazide.
| Compound Name | pentane-1,3,5-tricarbohydrazide |
|---|---|
| PubChem CID | 18368507 |
| Molecular Formula | C8H18N6O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | pentane-1,3,5-tricarbohydrazide |
| SMILES | NNC(=O)CCC(CCC(=O)NN)C(=O)NN |
| InChI | InChI=1S/C8H18N6O3/c9-12-6(15)3-1-5(8(17)14-11)2-4-7(16)13-10/h5H,1-4,9-11H2,(H,12,15)(H,13,16)(H,14,17) |
| InChIKey | FYZRKOJDZDVLQL-UHFFFAOYSA-N |
| XLogP | -2.87 |
| TPSA | 165.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|