About 2-propylhexanehydrazide
2-propylhexanehydrazide (PubChem CID 86746660) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is 2-propylhexanehydrazide.
Molecular Properties
| Compound Name | 2-propylhexanehydrazide |
| PubChem CID | 86746660 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 2-propylhexanehydrazide |
| SMILES | CCCCC(CCC)C(=O)NN |
| InChI | InChI=1S/C9H20N2O/c1-3-5-7-8(6-4-2)9(12)11-10/h8H,3-7,10H2,1-2H3,(H,11,12) |
| InChIKey | UBIQMJIWWYPHPQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-propylhexanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylhexanehydrazide?
The IUPAC name of 2-propylhexanehydrazide (CID 86746660) is 2-propylhexanehydrazide.
What is the SMILES notation for 2-propylhexanehydrazide?
The canonical SMILES for 2-propylhexanehydrazide is CCCCC(CCC)C(=O)NN.
What is the InChIKey of 2-propylhexanehydrazide?
The InChIKey is UBIQMJIWWYPHPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O/c1-3-5-7-8(6-4-2)9(12)11-10/h8H,3-7,10H2,1-2H3,(H,11,12).
What are the key properties of 2-propylhexanehydrazide?
2-propylhexanehydrazide has a molecular weight of 172.27 g/mol, XLogP of 1.58, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylhexanehydrazide is sourced from PubChem (CID 86746660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).