About phosphane;2-propylhexanoic acid
phosphane;2-propylhexanoic acid (PubChem CID 87429538) has the molecular formula C9H21O2P
and a molecular weight of 192.24 g/mol. Its IUPAC name is phosphane;2-propylhexanoic acid.
Molecular Properties
| Compound Name | phosphane;2-propylhexanoic acid |
| PubChem CID | 87429538 |
| Molecular Formula | C9H21O2P |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | phosphane;2-propylhexanoic acid |
| SMILES | CCCCC(CCC)C(=O)O.P |
| InChI | InChI=1S/C9H18O2.H3P/c1-3-5-7-8(6-4-2)9(10)11;/h8H,3-7H2,1-2H3,(H,10,11);1H3 |
| InChIKey | QOXHUZBHPBXGAX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphane;2-propylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphane;2-propylhexanoic acid?
The IUPAC name of phosphane;2-propylhexanoic acid (CID 87429538) is phosphane;2-propylhexanoic acid.
What is the SMILES notation for phosphane;2-propylhexanoic acid?
The canonical SMILES for phosphane;2-propylhexanoic acid is CCCCC(CCC)C(=O)O.P.
What is the InChIKey of phosphane;2-propylhexanoic acid?
The InChIKey is QOXHUZBHPBXGAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2.H3P/c1-3-5-7-8(6-4-2)9(10)11;/h8H,3-7H2,1-2H3,(H,10,11);1H3.
What are the key properties of phosphane;2-propylhexanoic acid?
phosphane;2-propylhexanoic acid has a molecular weight of 192.24 g/mol, XLogP of 2.74, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phosphane;2-propylhexanoic acid is sourced from PubChem (CID 87429538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).