About CID 87702087
CID 87702087 (PubChem CID 87702087) has the molecular formula C10H20O2Sn
and a molecular weight of 290.98 g/mol.
Molecular Properties
| Compound Name | CID 87702087 |
| PubChem CID | 87702087 |
| Molecular Formula | C10H20O2Sn |
| Molecular Weight | 290.98 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | — |
| SMILES | CCCCC(CCCC)C(=O)O.[Sn] |
| InChI | InChI=1S/C10H20O2.Sn/c1-3-5-7-9(10(11)12)8-6-4-2;/h9H,3-8H2,1-2H3,(H,11,12); |
| InChIKey | VIFFNYAVJACGFW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.98 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 87702087 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87702087?
The IUPAC name of CID 87702087 (CID 87702087) is not available.
What is the SMILES notation for CID 87702087?
The canonical SMILES for CID 87702087 is CCCCC(CCCC)C(=O)O.[Sn].
What is the InChIKey of CID 87702087?
The InChIKey is VIFFNYAVJACGFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.Sn/c1-3-5-7-9(10(11)12)8-6-4-2;/h9H,3-8H2,1-2H3,(H,11,12);.
What are the key properties of CID 87702087?
CID 87702087 has a molecular weight of 290.98 g/mol, XLogP of 2.69, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87702087 is sourced from PubChem (CID 87702087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).