About 2-octylbutanedihydrazide
2-octylbutanedihydrazide (PubChem CID 19764915) has the molecular formula C12H26N4O2
and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-octylbutanedihydrazide.
Molecular Properties
| Compound Name | 2-octylbutanedihydrazide |
| PubChem CID | 19764915 |
| Molecular Formula | C12H26N4O2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 2-octylbutanedihydrazide |
| SMILES | CCCCCCCCC(CC(=O)NN)C(=O)NN |
| InChI | InChI=1S/C12H26N4O2/c1-2-3-4-5-6-7-8-10(12(18)16-14)9-11(17)15-13/h10H,2-9,13-14H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | KCWFQBNIKKWCJP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-octylbutanedihydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octylbutanedihydrazide?
The IUPAC name of 2-octylbutanedihydrazide (CID 19764915) is 2-octylbutanedihydrazide.
What is the SMILES notation for 2-octylbutanedihydrazide?
The canonical SMILES for 2-octylbutanedihydrazide is CCCCCCCCC(CC(=O)NN)C(=O)NN.
What is the InChIKey of 2-octylbutanedihydrazide?
The InChIKey is KCWFQBNIKKWCJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N4O2/c1-2-3-4-5-6-7-8-10(12(18)16-14)9-11(17)15-13/h10H,2-9,13-14H2,1H3,(H,15,17)(H,16,18).
What are the key properties of 2-octylbutanedihydrazide?
2-octylbutanedihydrazide has a molecular weight of 258.37 g/mol, XLogP of 0.72, 10 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octylbutanedihydrazide is sourced from PubChem (CID 19764915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).