About 2-methylpentanehydrazide
2-methylpentanehydrazide (PubChem CID 43183484) has the molecular formula C6H14N2O
and a molecular weight of 130.19 g/mol. Its IUPAC name is 2-methylpentanehydrazide.
Molecular Properties
| Compound Name | 2-methylpentanehydrazide |
| PubChem CID | 43183484 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | 2-methylpentanehydrazide |
| SMILES | CCCC(C)C(=O)NN |
| InChI | InChI=1S/C6H14N2O/c1-3-4-5(2)6(9)8-7/h5H,3-4,7H2,1-2H3,(H,8,9) |
| InChIKey | FVYIOYFXCYBUEU-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpentanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentanehydrazide?
The IUPAC name of 2-methylpentanehydrazide (CID 43183484) is 2-methylpentanehydrazide.
What is the SMILES notation for 2-methylpentanehydrazide?
The canonical SMILES for 2-methylpentanehydrazide is CCCC(C)C(=O)NN.
What is the InChIKey of 2-methylpentanehydrazide?
The InChIKey is FVYIOYFXCYBUEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O/c1-3-4-5(2)6(9)8-7/h5H,3-4,7H2,1-2H3,(H,8,9).
What are the key properties of 2-methylpentanehydrazide?
2-methylpentanehydrazide has a molecular weight of 130.19 g/mol, XLogP of 0.41, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentanehydrazide is sourced from PubChem (CID 43183484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).