C11H22O — CID 177467625
(6S)-4,6-dimethylnonan-5-one (PubChem CID 177467625) has the molecular formula C11H22O and a molecular weight of 170.30 g/mol. Its IUPAC name is (6S)-4,6-dimethylnonan-5-one.
| Compound Name | (6S)-4,6-dimethylnonan-5-one |
|---|---|
| PubChem CID | 177467625 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | (6S)-4,6-dimethylnonan-5-one |
| SMILES | CCCC(C)C(=O)[C@@H](C)CCC |
| InChI | InChI=1S/C11H22O/c1-5-7-9(3)11(12)10(4)8-6-2/h9-10H,5-8H2,1-4H3/t9-,10?/m0/s1 |
| InChIKey | YGDJOFDNZUXEMG-RGURZIINSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |