C17H34O — CID 150096425
4,6,8,10-tetramethyltridecan-7-one (PubChem CID 150096425) has the molecular formula C17H34O and a molecular weight of 254.46 g/mol. Its IUPAC name is 4,6,8,10-tetramethyltridecan-7-one.
| Compound Name | 4,6,8,10-tetramethyltridecan-7-one |
|---|---|
| PubChem CID | 150096425 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | 4,6,8,10-tetramethyltridecan-7-one |
| SMILES | CCCC(C)CC(C)C(=O)C(C)CC(C)CCC |
| InChI | InChI=1S/C17H34O/c1-7-9-13(3)11-15(5)17(18)16(6)12-14(4)10-8-2/h13-16H,7-12H2,1-6H3 |
| InChIKey | DUIHRCIODNUNCV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |