C37H74O — CID 174871852
2,4,9,11,13,15,20,22-octamethyl-7,17-di(propan-2-yl)tricosan-12-one (PubChem CID 174871852) has the molecular formula C37H74O and a molecular weight of 535.00 g/mol. Its IUPAC name is 2,4,9,11,13,15,20,22-octamethyl-7,17-di(propan-2-yl)tricosan-12-one.
| Compound Name | 2,4,9,11,13,15,20,22-octamethyl-7,17-di(propan-2-yl)tricosan-12-one |
|---|---|
| PubChem CID | 174871852 |
| Molecular Formula | C37H74O |
| Molecular Weight | 535.00 g/mol |
| Exact Mass | 534.57 |
| IUPAC Name | 2,4,9,11,13,15,20,22-octamethyl-7,17-di(propan-2-yl)tricosan-12-one |
| SMILES | CC(C)CC(C)CCC(CC(C)CC(C)C(=O)C(C)CC(C)CC(CCC(C)CC(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C37H74O/c1-25(2)19-29(9)15-17-35(27(5)6)23-31(11)21-33(13)37(38)34(14)22-32(12)24-36(28(7)8)18-16-30(10)20-26(3)4/h25-36H,15-24H2,1-14H3 |
| InChIKey | IAXWQLGQMQOONT-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.00 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |