C15H26O3 — CID 150395094
3,5,7,9-tetramethylundecane-2,6,10-trione (PubChem CID 150395094) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is 3,5,7,9-tetramethylundecane-2,6,10-trione.
| Compound Name | 3,5,7,9-tetramethylundecane-2,6,10-trione |
|---|---|
| PubChem CID | 150395094 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 3,5,7,9-tetramethylundecane-2,6,10-trione |
| SMILES | CC(=O)C(C)CC(C)C(=O)C(C)CC(C)C(C)=O |
| InChI | InChI=1S/C15H26O3/c1-9(13(5)16)7-11(3)15(18)12(4)8-10(2)14(6)17/h9-12H,7-8H2,1-6H3 |
| InChIKey | HCNWJRNNOWBZPT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |