About 3-methylbutan-2-one;3-methylpentan-2-one
3-methylbutan-2-one;3-methylpentan-2-one (PubChem CID 159429251) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is 3-methylbutan-2-one;3-methylpentan-2-one.
Molecular Properties
| Compound Name | 3-methylbutan-2-one;3-methylpentan-2-one |
| PubChem CID | 159429251 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 3-methylbutan-2-one;3-methylpentan-2-one |
| SMILES | CC(=O)C(C)C.CCC(C)C(C)=O |
| InChI | InChI=1S/C6H12O.C5H10O/c1-4-5(2)6(3)7;1-4(2)5(3)6/h5H,4H2,1-3H3;4H,1-3H3 |
| InChIKey | LQTUAUPWKNTXNG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylbutan-2-one;3-methylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-2-one;3-methylpentan-2-one?
The IUPAC name of 3-methylbutan-2-one;3-methylpentan-2-one (CID 159429251) is 3-methylbutan-2-one;3-methylpentan-2-one.
What is the SMILES notation for 3-methylbutan-2-one;3-methylpentan-2-one?
The canonical SMILES for 3-methylbutan-2-one;3-methylpentan-2-one is CC(=O)C(C)C.CCC(C)C(C)=O.
What is the InChIKey of 3-methylbutan-2-one;3-methylpentan-2-one?
The InChIKey is LQTUAUPWKNTXNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.C5H10O/c1-4-5(2)6(3)7;1-4(2)5(3)6/h5H,4H2,1-3H3;4H,1-3H3.
What are the key properties of 3-methylbutan-2-one;3-methylpentan-2-one?
3-methylbutan-2-one;3-methylpentan-2-one has a molecular weight of 186.29 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-2-one;3-methylpentan-2-one is sourced from PubChem (CID 159429251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).