About (3S)-3-hydroxybutan-2-one;3-methylbutan-2-one
(3S)-3-hydroxybutan-2-one;3-methylbutan-2-one (PubChem CID 161241021) has the molecular formula C9H18O3
and a molecular weight of 174.24 g/mol. Its IUPAC name is (3S)-3-hydroxybutan-2-one;3-methylbutan-2-one.
Molecular Properties
| Compound Name | (3S)-3-hydroxybutan-2-one;3-methylbutan-2-one |
| PubChem CID | 161241021 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | (3S)-3-hydroxybutan-2-one;3-methylbutan-2-one |
| SMILES | CC(=O)C(C)C.CC(=O)[C@H](C)O |
| InChI | InChI=1S/C5H10O.C4H8O2/c1-4(2)5(3)6;1-3(5)4(2)6/h4H,1-3H3;3,5H,1-2H3/t;3-/m.0/s1 |
| InChIKey | UZZRKGOIVNCADL-HVDRVSQOSA-N |
| XLogP | 1.19 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-hydroxybutan-2-one;3-methylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-hydroxybutan-2-one;3-methylbutan-2-one?
The IUPAC name of (3S)-3-hydroxybutan-2-one;3-methylbutan-2-one (CID 161241021) is (3S)-3-hydroxybutan-2-one;3-methylbutan-2-one.
What is the SMILES notation for (3S)-3-hydroxybutan-2-one;3-methylbutan-2-one?
The canonical SMILES for (3S)-3-hydroxybutan-2-one;3-methylbutan-2-one is CC(=O)C(C)C.CC(=O)[C@H](C)O.
What is the InChIKey of (3S)-3-hydroxybutan-2-one;3-methylbutan-2-one?
The InChIKey is UZZRKGOIVNCADL-HVDRVSQOSA-N. The full InChI is InChI=1S/C5H10O.C4H8O2/c1-4(2)5(3)6;1-3(5)4(2)6/h4H,1-3H3;3,5H,1-2H3/t;3-/m.0/s1.
What are the key properties of (3S)-3-hydroxybutan-2-one;3-methylbutan-2-one?
(3S)-3-hydroxybutan-2-one;3-methylbutan-2-one has a molecular weight of 174.24 g/mol, XLogP of 1.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-hydroxybutan-2-one;3-methylbutan-2-one is sourced from PubChem (CID 161241021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).