About 2-hydroxypropanoate;oxoazanium;acetate
2-hydroxypropanoate;oxoazanium;acetate (PubChem CID 140813979) has the molecular formula C5H12N2O7
and a molecular weight of 212.16 g/mol. Its IUPAC name is 2-hydroxypropanoate;oxoazanium;acetate.
Molecular Properties
| Compound Name | 2-hydroxypropanoate;oxoazanium;acetate |
| PubChem CID | 140813979 |
| Molecular Formula | C5H12N2O7 |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 2-hydroxypropanoate;oxoazanium;acetate |
| SMILES | CC(=O)[O-].CC(O)C(=O)[O-].[NH2+]=O.[NH2+]=O |
| InChI | InChI=1S/C3H6O3.C2H4O2.2H2NO/c1-2(4)3(5)6;1-2(3)4;2*1-2/h2,4H,1H3,(H,5,6);1H3,(H,3,4);2*1H2/q;;2*+1/p-2 |
| InChIKey | OANUNJIVHYVPCS-UHFFFAOYSA-L |
| XLogP | -6.10 |
| TPSA | 185.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | -6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-hydroxypropanoate;oxoazanium;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropanoate;oxoazanium;acetate?
The IUPAC name of 2-hydroxypropanoate;oxoazanium;acetate (CID 140813979) is 2-hydroxypropanoate;oxoazanium;acetate.
What is the SMILES notation for 2-hydroxypropanoate;oxoazanium;acetate?
The canonical SMILES for 2-hydroxypropanoate;oxoazanium;acetate is CC(=O)[O-].CC(O)C(=O)[O-].[NH2+]=O.[NH2+]=O.
What is the InChIKey of 2-hydroxypropanoate;oxoazanium;acetate?
The InChIKey is OANUNJIVHYVPCS-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H6O3.C2H4O2.2H2NO/c1-2(4)3(5)6;1-2(3)4;2*1-2/h2,4H,1H3,(H,5,6);1H3,(H,3,4);2*1H2/q;;2*+1/p-2.
What are the key properties of 2-hydroxypropanoate;oxoazanium;acetate?
2-hydroxypropanoate;oxoazanium;acetate has a molecular weight of 212.16 g/mol, XLogP of -6.10, 1 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropanoate;oxoazanium;acetate is sourced from PubChem (CID 140813979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).