About 2-hydroxypropanoate;tantalum(5+)
2-hydroxypropanoate;tantalum(5+) (PubChem CID 172796362) has the molecular formula C3H5O3Ta+4
and a molecular weight of 270.02 g/mol. Its IUPAC name is 2-hydroxypropanoate;tantalum(5+).
Molecular Properties
| Compound Name | 2-hydroxypropanoate;tantalum(5+) |
| PubChem CID | 172796362 |
| Molecular Formula | C3H5O3Ta+4 |
| Molecular Weight | 270.02 g/mol |
| Exact Mass | 269.97 |
| IUPAC Name | 2-hydroxypropanoate;tantalum(5+) |
| SMILES | CC(O)C(=O)[O-].[Ta+5] |
| InChI | InChI=1S/C3H6O3.Ta/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+5/p-1 |
| InChIKey | QGGQFNXJCNFWEP-UHFFFAOYSA-M |
| XLogP | -1.89 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.02 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxypropanoate;tantalum(5+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropanoate;tantalum(5+)?
The IUPAC name of 2-hydroxypropanoate;tantalum(5+) (CID 172796362) is 2-hydroxypropanoate;tantalum(5+).
What is the SMILES notation for 2-hydroxypropanoate;tantalum(5+)?
The canonical SMILES for 2-hydroxypropanoate;tantalum(5+) is CC(O)C(=O)[O-].[Ta+5].
What is the InChIKey of 2-hydroxypropanoate;tantalum(5+)?
The InChIKey is QGGQFNXJCNFWEP-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O3.Ta/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+5/p-1.
What are the key properties of 2-hydroxypropanoate;tantalum(5+)?
2-hydroxypropanoate;tantalum(5+) has a molecular weight of 270.02 g/mol, XLogP of -1.89, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropanoate;tantalum(5+) is sourced from PubChem (CID 172796362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).