About silver (2R)-2-hydroxypropanoate
silver (2R)-2-hydroxypropanoate (PubChem CID 14178856) has the molecular formula C3H5AgO3
and a molecular weight of 196.94 g/mol. Its IUPAC name is silver (2R)-2-hydroxypropanoate.
Molecular Properties
| Compound Name | silver (2R)-2-hydroxypropanoate |
| PubChem CID | 14178856 |
| Molecular Formula | C3H5AgO3 |
| Molecular Weight | 196.94 g/mol |
| Exact Mass | 195.93 |
| IUPAC Name | silver (2R)-2-hydroxypropanoate |
| SMILES | C[C@@H](O)C(=O)[O-].[Ag+] |
| InChI | InChI=1S/C3H6O3.Ag/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1/t2-;/m1./s1 |
| InChIKey | LMEWRZSPCQHBOB-HSHFZTNMSA-M |
| XLogP | -1.89 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.94 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze silver (2R)-2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver (2R)-2-hydroxypropanoate?
The IUPAC name of silver (2R)-2-hydroxypropanoate (CID 14178856) is silver (2R)-2-hydroxypropanoate.
What is the SMILES notation for silver (2R)-2-hydroxypropanoate?
The canonical SMILES for silver (2R)-2-hydroxypropanoate is C[C@@H](O)C(=O)[O-].[Ag+].
What is the InChIKey of silver (2R)-2-hydroxypropanoate?
The InChIKey is LMEWRZSPCQHBOB-HSHFZTNMSA-M. The full InChI is InChI=1S/C3H6O3.Ag/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1/t2-;/m1./s1.
What are the key properties of silver (2R)-2-hydroxypropanoate?
silver (2R)-2-hydroxypropanoate has a molecular weight of 196.94 g/mol, XLogP of -1.89, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for silver (2R)-2-hydroxypropanoate is sourced from PubChem (CID 14178856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).