About strontium bis(2-hydroxypropanoate)
strontium bis(2-hydroxypropanoate) (PubChem CID 91886528) has the molecular formula C6H10O6Sr
and a molecular weight of 265.76 g/mol. Its IUPAC name is strontium bis(2-hydroxypropanoate).
Molecular Properties
| Compound Name | strontium bis(2-hydroxypropanoate) |
| PubChem CID | 91886528 |
| Molecular Formula | C6H10O6Sr |
| Molecular Weight | 265.76 g/mol |
| Exact Mass | 265.95 |
| IUPAC Name | strontium bis(2-hydroxypropanoate) |
| SMILES | CC(O)C(=O)[O-].CC(O)C(=O)[O-].[Sr+2] |
| InChI | InChI=1S/2C3H6O3.Sr/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | CCUZKVDGQHXAFK-UHFFFAOYSA-L |
| XLogP | -4.15 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.76 |
| LogP ≤ 5 | -4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze strontium bis(2-hydroxypropanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of strontium bis(2-hydroxypropanoate)?
The IUPAC name of strontium bis(2-hydroxypropanoate) (CID 91886528) is strontium bis(2-hydroxypropanoate).
What is the SMILES notation for strontium bis(2-hydroxypropanoate)?
The canonical SMILES for strontium bis(2-hydroxypropanoate) is CC(O)C(=O)[O-].CC(O)C(=O)[O-].[Sr+2].
What is the InChIKey of strontium bis(2-hydroxypropanoate)?
The InChIKey is CCUZKVDGQHXAFK-UHFFFAOYSA-L. The full InChI is InChI=1S/2C3H6O3.Sr/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);/q;;+2/p-2.
What are the key properties of strontium bis(2-hydroxypropanoate)?
strontium bis(2-hydroxypropanoate) has a molecular weight of 265.76 g/mol, XLogP of -4.15, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for strontium bis(2-hydroxypropanoate) is sourced from PubChem (CID 91886528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).