About potassium 2-hydroxypropanoate
potassium 2-hydroxypropanoate (PubChem CID 23671663) has the molecular formula C3H5KO3
and a molecular weight of 128.17 g/mol. Its IUPAC name is potassium 2-hydroxypropanoate.
Molecular Properties
| Compound Name | potassium 2-hydroxypropanoate |
| PubChem CID | 23671663 |
| Molecular Formula | C3H5KO3 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 127.99 |
| IUPAC Name | potassium 2-hydroxypropanoate |
| SMILES | CC(O)C(=O)[O-].[K+] |
| InChI | InChI=1S/C3H6O3.K/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1 |
| InChIKey | PHZLMBHDXVLRIX-UHFFFAOYSA-M |
| XLogP | -4.88 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | -4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-hydroxypropanoate?
The IUPAC name of potassium 2-hydroxypropanoate (CID 23671663) is potassium 2-hydroxypropanoate.
What is the SMILES notation for potassium 2-hydroxypropanoate?
The canonical SMILES for potassium 2-hydroxypropanoate is CC(O)C(=O)[O-].[K+].
What is the InChIKey of potassium 2-hydroxypropanoate?
The InChIKey is PHZLMBHDXVLRIX-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O3.K/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1.
What are the key properties of potassium 2-hydroxypropanoate?
potassium 2-hydroxypropanoate has a molecular weight of 128.17 g/mol, XLogP of -4.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-hydroxypropanoate is sourced from PubChem (CID 23671663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).