About copper bis(2-hydroxypropanoate)
copper bis(2-hydroxypropanoate) (PubChem CID 13145) has the molecular formula C6H10CuO6
and a molecular weight of 241.69 g/mol. Its IUPAC name is copper bis(2-hydroxypropanoate).
Molecular Properties
| Compound Name | copper bis(2-hydroxypropanoate) |
| PubChem CID | 13145 |
| Molecular Formula | C6H10CuO6 |
| Molecular Weight | 241.69 g/mol |
| Exact Mass | 240.98 |
| IUPAC Name | copper bis(2-hydroxypropanoate) |
| SMILES | CC(O)C(=O)[O-].CC(O)C(=O)[O-].[Cu+2] |
| InChI | InChI=1S/2C3H6O3.Cu/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | DYROSKSLMAPFBZ-UHFFFAOYSA-L |
| XLogP | -3.77 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.69 |
| LogP ≤ 5 | -3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze copper bis(2-hydroxypropanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper bis(2-hydroxypropanoate)?
The IUPAC name of copper bis(2-hydroxypropanoate) (CID 13145) is copper bis(2-hydroxypropanoate).
What is the SMILES notation for copper bis(2-hydroxypropanoate)?
The canonical SMILES for copper bis(2-hydroxypropanoate) is CC(O)C(=O)[O-].CC(O)C(=O)[O-].[Cu+2].
What is the InChIKey of copper bis(2-hydroxypropanoate)?
The InChIKey is DYROSKSLMAPFBZ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C3H6O3.Cu/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);/q;;+2/p-2.
What are the key properties of copper bis(2-hydroxypropanoate)?
copper bis(2-hydroxypropanoate) has a molecular weight of 241.69 g/mol, XLogP of -3.77, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper bis(2-hydroxypropanoate) is sourced from PubChem (CID 13145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).