About iodanium 2-hydroxypropanoate
iodanium 2-hydroxypropanoate (PubChem CID 158316585) has the molecular formula C3H7IO3
and a molecular weight of 217.99 g/mol. Its IUPAC name is iodanium 2-hydroxypropanoate.
Molecular Properties
| Compound Name | iodanium 2-hydroxypropanoate |
| PubChem CID | 158316585 |
| Molecular Formula | C3H7IO3 |
| Molecular Weight | 217.99 g/mol |
| Exact Mass | 217.94 |
| IUPAC Name | iodanium 2-hydroxypropanoate |
| SMILES | CC(O)C(=O)[O-].[IH2+] |
| InChI | InChI=1S/C3H6O3.H2I/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);1H2/q;+1/p-1 |
| InChIKey | GOIGJYUUVGCJNH-UHFFFAOYSA-M |
| XLogP | -5.41 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.99 |
| LogP ≤ 5 | -5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodanium 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodanium 2-hydroxypropanoate?
The IUPAC name of iodanium 2-hydroxypropanoate (CID 158316585) is iodanium 2-hydroxypropanoate.
What is the SMILES notation for iodanium 2-hydroxypropanoate?
The canonical SMILES for iodanium 2-hydroxypropanoate is CC(O)C(=O)[O-].[IH2+].
What is the InChIKey of iodanium 2-hydroxypropanoate?
The InChIKey is GOIGJYUUVGCJNH-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O3.H2I/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);1H2/q;+1/p-1.
What are the key properties of iodanium 2-hydroxypropanoate?
iodanium 2-hydroxypropanoate has a molecular weight of 217.99 g/mol, XLogP of -5.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iodanium 2-hydroxypropanoate is sourced from PubChem (CID 158316585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).