About potassium;2-hydroxypropanoate;zirconium
potassium;2-hydroxypropanoate;zirconium (PubChem CID 87220091) has the molecular formula C3H5KO3Zr
and a molecular weight of 219.39 g/mol. Its IUPAC name is potassium;2-hydroxypropanoate;zirconium.
Molecular Properties
| Compound Name | potassium;2-hydroxypropanoate;zirconium |
| PubChem CID | 87220091 |
| Molecular Formula | C3H5KO3Zr |
| Molecular Weight | 219.39 g/mol |
| Exact Mass | 217.89 |
| IUPAC Name | potassium;2-hydroxypropanoate;zirconium |
| SMILES | CC(O)C(=O)[O-].[K+].[Zr] |
| InChI | InChI=1S/C3H6O3.K.Zr/c1-2(4)3(5)6;;/h2,4H,1H3,(H,5,6);;/q;+1;/p-1 |
| InChIKey | HLISUCJLQJRMHL-UHFFFAOYSA-M |
| XLogP | -4.88 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.39 |
| LogP ≤ 5 | -4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium;2-hydroxypropanoate;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2-hydroxypropanoate;zirconium?
The IUPAC name of potassium;2-hydroxypropanoate;zirconium (CID 87220091) is potassium;2-hydroxypropanoate;zirconium.
What is the SMILES notation for potassium;2-hydroxypropanoate;zirconium?
The canonical SMILES for potassium;2-hydroxypropanoate;zirconium is CC(O)C(=O)[O-].[K+].[Zr].
What is the InChIKey of potassium;2-hydroxypropanoate;zirconium?
The InChIKey is HLISUCJLQJRMHL-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O3.K.Zr/c1-2(4)3(5)6;;/h2,4H,1H3,(H,5,6);;/q;+1;/p-1.
What are the key properties of potassium;2-hydroxypropanoate;zirconium?
potassium;2-hydroxypropanoate;zirconium has a molecular weight of 219.39 g/mol, XLogP of -4.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2-hydroxypropanoate;zirconium is sourced from PubChem (CID 87220091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).