About sodium;2-hydroxypropanoate;oxalic acid
sodium;2-hydroxypropanoate;oxalic acid (PubChem CID 172762008) has the molecular formula C5H7NaO7
and a molecular weight of 202.09 g/mol. Its IUPAC name is sodium;2-hydroxypropanoate;oxalic acid.
Molecular Properties
| Compound Name | sodium;2-hydroxypropanoate;oxalic acid |
| PubChem CID | 172762008 |
| Molecular Formula | C5H7NaO7 |
| Molecular Weight | 202.09 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | sodium;2-hydroxypropanoate;oxalic acid |
| SMILES | CC(O)C(=O)[O-].O=C(O)C(=O)O.[Na+] |
| InChI | InChI=1S/C3H6O3.C2H2O4.Na/c1-2(4)3(5)6;3-1(4)2(5)6;/h2,4H,1H3,(H,5,6);(H,3,4)(H,5,6);/q;;+1/p-1 |
| InChIKey | LUSHMCRKXXHVBH-UHFFFAOYSA-M |
| XLogP | -5.72 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.09 |
| LogP ≤ 5 | -5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-hydroxypropanoate;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-hydroxypropanoate;oxalic acid?
The IUPAC name of sodium;2-hydroxypropanoate;oxalic acid (CID 172762008) is sodium;2-hydroxypropanoate;oxalic acid.
What is the SMILES notation for sodium;2-hydroxypropanoate;oxalic acid?
The canonical SMILES for sodium;2-hydroxypropanoate;oxalic acid is CC(O)C(=O)[O-].O=C(O)C(=O)O.[Na+].
What is the InChIKey of sodium;2-hydroxypropanoate;oxalic acid?
The InChIKey is LUSHMCRKXXHVBH-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O3.C2H2O4.Na/c1-2(4)3(5)6;3-1(4)2(5)6;/h2,4H,1H3,(H,5,6);(H,3,4)(H,5,6);/q;;+1/p-1.
What are the key properties of sodium;2-hydroxypropanoate;oxalic acid?
sodium;2-hydroxypropanoate;oxalic acid has a molecular weight of 202.09 g/mol, XLogP of -5.72, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-hydroxypropanoate;oxalic acid is sourced from PubChem (CID 172762008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).