About 2-hydroxypropanoate;iridium(3+);acetate
2-hydroxypropanoate;iridium(3+);acetate (PubChem CID 157323915) has the molecular formula C5H8IrO5+
and a molecular weight of 340.33 g/mol. Its IUPAC name is 2-hydroxypropanoate;iridium(3+);acetate.
Molecular Properties
| Compound Name | 2-hydroxypropanoate;iridium(3+);acetate |
| PubChem CID | 157323915 |
| Molecular Formula | C5H8IrO5+ |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 2-hydroxypropanoate;iridium(3+);acetate |
| SMILES | CC(=O)[O-].CC(O)C(=O)[O-].[Ir+3] |
| InChI | InChI=1S/C3H6O3.C2H4O2.Ir/c1-2(4)3(5)6;1-2(3)4;/h2,4H,1H3,(H,5,6);1H3,(H,3,4);/q;;+3/p-2 |
| InChIKey | QGLRLWHTDLWWMK-UHFFFAOYSA-L |
| XLogP | -3.13 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-hydroxypropanoate;iridium(3+);acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropanoate;iridium(3+);acetate?
The IUPAC name of 2-hydroxypropanoate;iridium(3+);acetate (CID 157323915) is 2-hydroxypropanoate;iridium(3+);acetate.
What is the SMILES notation for 2-hydroxypropanoate;iridium(3+);acetate?
The canonical SMILES for 2-hydroxypropanoate;iridium(3+);acetate is CC(=O)[O-].CC(O)C(=O)[O-].[Ir+3].
What is the InChIKey of 2-hydroxypropanoate;iridium(3+);acetate?
The InChIKey is QGLRLWHTDLWWMK-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H6O3.C2H4O2.Ir/c1-2(4)3(5)6;1-2(3)4;/h2,4H,1H3,(H,5,6);1H3,(H,3,4);/q;;+3/p-2.
What are the key properties of 2-hydroxypropanoate;iridium(3+);acetate?
2-hydroxypropanoate;iridium(3+);acetate has a molecular weight of 340.33 g/mol, XLogP of -3.13, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropanoate;iridium(3+);acetate is sourced from PubChem (CID 157323915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).