About lithium;hydride;3-methylbutan-2-one
lithium;hydride;3-methylbutan-2-one (PubChem CID 173095274) has the molecular formula C5H11LiO
and a molecular weight of 94.08 g/mol. Its IUPAC name is lithium;hydride;3-methylbutan-2-one.
Molecular Properties
| Compound Name | lithium;hydride;3-methylbutan-2-one |
| PubChem CID | 173095274 |
| Molecular Formula | C5H11LiO |
| Molecular Weight | 94.08 g/mol |
| Exact Mass | 94.10 |
| IUPAC Name | lithium;hydride;3-methylbutan-2-one |
| SMILES | CC(=O)C(C)C.[H-].[Li+] |
| InChI | InChI=1S/C5H10O.Li.H/c1-4(2)5(3)6;;/h4H,1-3H3;;/q;+1;-1 |
| InChIKey | IUOWQMQKMQPYKX-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 94.08 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze lithium;hydride;3-methylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;3-methylbutan-2-one?
The IUPAC name of lithium;hydride;3-methylbutan-2-one (CID 173095274) is lithium;hydride;3-methylbutan-2-one.
What is the SMILES notation for lithium;hydride;3-methylbutan-2-one?
The canonical SMILES for lithium;hydride;3-methylbutan-2-one is CC(=O)C(C)C.[H-].[Li+].
What is the InChIKey of lithium;hydride;3-methylbutan-2-one?
The InChIKey is IUOWQMQKMQPYKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.Li.H/c1-4(2)5(3)6;;/h4H,1-3H3;;/q;+1;-1.
What are the key properties of lithium;hydride;3-methylbutan-2-one?
lithium;hydride;3-methylbutan-2-one has a molecular weight of 94.08 g/mol, XLogP of -1.65, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;3-methylbutan-2-one is sourced from PubChem (CID 173095274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).