About (3R)-3-fluorobutan-2-one
(3R)-3-fluorobutan-2-one (PubChem CID 638120) has the molecular formula C4H7FO
and a molecular weight of 90.10 g/mol. Its IUPAC name is (3R)-3-fluorobutan-2-one.
Molecular Properties
| Compound Name | (3R)-3-fluorobutan-2-one |
| PubChem CID | 638120 |
| Molecular Formula | C4H7FO |
| Molecular Weight | 90.10 g/mol |
| Exact Mass | 90.05 |
| IUPAC Name | (3R)-3-fluorobutan-2-one |
| SMILES | CC(=O)[C@@H](C)F |
| InChI | InChI=1S/C4H7FO/c1-3(5)4(2)6/h3H,1-2H3/t3-/m1/s1 |
| InChIKey | LJOQCXPELWJBRK-GSVOUGTGSA-N |
| XLogP | 0.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.10 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R)-3-fluorobutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-fluorobutan-2-one?
The IUPAC name of (3R)-3-fluorobutan-2-one (CID 638120) is (3R)-3-fluorobutan-2-one.
What is the SMILES notation for (3R)-3-fluorobutan-2-one?
The canonical SMILES for (3R)-3-fluorobutan-2-one is CC(=O)[C@@H](C)F.
What is the InChIKey of (3R)-3-fluorobutan-2-one?
The InChIKey is LJOQCXPELWJBRK-GSVOUGTGSA-N. The full InChI is InChI=1S/C4H7FO/c1-3(5)4(2)6/h3H,1-2H3/t3-/m1/s1.
What are the key properties of (3R)-3-fluorobutan-2-one?
(3R)-3-fluorobutan-2-one has a molecular weight of 90.10 g/mol, XLogP of 0.93, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-fluorobutan-2-one is sourced from PubChem (CID 638120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).