About 1,1-difluoropropan-2-one;propan-2-one
1,1-difluoropropan-2-one;propan-2-one (PubChem CID 157104644) has the molecular formula C6H10F2O2
and a molecular weight of 152.14 g/mol. Its IUPAC name is 1,1-difluoropropan-2-one;propan-2-one.
Molecular Properties
| Compound Name | 1,1-difluoropropan-2-one;propan-2-one |
| PubChem CID | 157104644 |
| Molecular Formula | C6H10F2O2 |
| Molecular Weight | 152.14 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 1,1-difluoropropan-2-one;propan-2-one |
| SMILES | CC(=O)C(F)F.CC(C)=O |
| InChI | InChI=1S/C3H4F2O.C3H6O/c1-2(6)3(4)5;1-3(2)4/h3H,1H3;1-2H3 |
| InChIKey | AGDVLTNDIQURJV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.14 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1-difluoropropan-2-one;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoropropan-2-one;propan-2-one?
The IUPAC name of 1,1-difluoropropan-2-one;propan-2-one (CID 157104644) is 1,1-difluoropropan-2-one;propan-2-one.
What is the SMILES notation for 1,1-difluoropropan-2-one;propan-2-one?
The canonical SMILES for 1,1-difluoropropan-2-one;propan-2-one is CC(=O)C(F)F.CC(C)=O.
What is the InChIKey of 1,1-difluoropropan-2-one;propan-2-one?
The InChIKey is AGDVLTNDIQURJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4F2O.C3H6O/c1-2(6)3(4)5;1-3(2)4/h3H,1H3;1-2H3.
What are the key properties of 1,1-difluoropropan-2-one;propan-2-one?
1,1-difluoropropan-2-one;propan-2-one has a molecular weight of 152.14 g/mol, XLogP of 1.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoropropan-2-one;propan-2-one is sourced from PubChem (CID 157104644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).