About propan-2-one;zirconium
propan-2-one;zirconium (PubChem CID 87087539) has the molecular formula C3H6OZr
and a molecular weight of 149.30 g/mol. Its IUPAC name is propan-2-one;zirconium.
Molecular Properties
| Compound Name | propan-2-one;zirconium |
| PubChem CID | 87087539 |
| Molecular Formula | C3H6OZr |
| Molecular Weight | 149.30 g/mol |
| Exact Mass | 147.95 |
| IUPAC Name | propan-2-one;zirconium |
| SMILES | CC(C)=O.[Zr] |
| InChI | InChI=1S/C3H6O.Zr/c1-3(2)4;/h1-2H3; |
| InChIKey | AMPWJYZVAULOEI-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propan-2-one;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-one;zirconium?
The IUPAC name of propan-2-one;zirconium (CID 87087539) is propan-2-one;zirconium.
What is the SMILES notation for propan-2-one;zirconium?
The canonical SMILES for propan-2-one;zirconium is CC(C)=O.[Zr].
What is the InChIKey of propan-2-one;zirconium?
The InChIKey is AMPWJYZVAULOEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.Zr/c1-3(2)4;/h1-2H3;.
What are the key properties of propan-2-one;zirconium?
propan-2-one;zirconium has a molecular weight of 149.30 g/mol, XLogP of 0.59, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-one;zirconium is sourced from PubChem (CID 87087539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).