About Silane-acetone
Silane-acetone (PubChem CID 18680436) has the molecular formula C3H6OSi
and a molecular weight of 86.17 g/mol.
Molecular Properties
| Compound Name | Silane-acetone |
| PubChem CID | 18680436 |
| Molecular Formula | C3H6OSi |
| Molecular Weight | 86.17 g/mol |
| Exact Mass | 86.02 |
| IUPAC Name | — |
| SMILES | CC(C)=O.[Si] |
| InChI | InChI=1S/C3H6O.Si/c1-3(2)4;/h1-2H3; |
| InChIKey | BHCIEQZOSOEXOJ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.17 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Silane-acetone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Silane-acetone?
The IUPAC name of Silane-acetone (CID 18680436) is not available.
What is the SMILES notation for Silane-acetone?
The canonical SMILES for Silane-acetone is CC(C)=O.[Si].
What is the InChIKey of Silane-acetone?
The InChIKey is BHCIEQZOSOEXOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.Si/c1-3(2)4;/h1-2H3;.
What are the key properties of Silane-acetone?
Silane-acetone has a molecular weight of 86.17 g/mol, XLogP of 0.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Silane-acetone is sourced from PubChem (CID 18680436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).