About propan-2-one;sulfur monoxide
propan-2-one;sulfur monoxide (PubChem CID 21387950) has the molecular formula C3H6O2S
and a molecular weight of 106.15 g/mol. Its IUPAC name is propan-2-one;sulfur monoxide.
Molecular Properties
| Compound Name | propan-2-one;sulfur monoxide |
| PubChem CID | 21387950 |
| Molecular Formula | C3H6O2S |
| Molecular Weight | 106.15 g/mol |
| Exact Mass | 106.01 |
| IUPAC Name | propan-2-one;sulfur monoxide |
| SMILES | CC(C)=O.O=S |
| InChI | InChI=1S/C3H6O.OS/c1-3(2)4;1-2/h1-2H3; |
| InChIKey | ZMZKRNFFYXCULH-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.15 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-one;sulfur monoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-one;sulfur monoxide?
The IUPAC name of propan-2-one;sulfur monoxide (CID 21387950) is propan-2-one;sulfur monoxide.
What is the SMILES notation for propan-2-one;sulfur monoxide?
The canonical SMILES for propan-2-one;sulfur monoxide is CC(C)=O.O=S.
What is the InChIKey of propan-2-one;sulfur monoxide?
The InChIKey is ZMZKRNFFYXCULH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.OS/c1-3(2)4;1-2/h1-2H3;.
What are the key properties of propan-2-one;sulfur monoxide?
propan-2-one;sulfur monoxide has a molecular weight of 106.15 g/mol, XLogP of 0.26, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-one;sulfur monoxide is sourced from PubChem (CID 21387950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).