About propane-2-thione;propan-2-imine;propan-2-one
propane-2-thione;propan-2-imine;propan-2-one (PubChem CID 160670260) has the molecular formula C9H19NOS
and a molecular weight of 189.32 g/mol. Its IUPAC name is propane-2-thione;propan-2-imine;propan-2-one.
Molecular Properties
| Compound Name | propane-2-thione;propan-2-imine;propan-2-one |
| PubChem CID | 160670260 |
| Molecular Formula | C9H19NOS |
| Molecular Weight | 189.32 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | propane-2-thione;propan-2-imine;propan-2-one |
| SMILES | CC(C)=O.CC(C)=S.[H]N=C(C)C |
| InChI | InChI=1S/C3H7N.C3H6O.C3H6S/c3*1-3(2)4/h4H,1-2H3;2*1-2H3 |
| InChIKey | RMVKLKDFEBTRSB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze propane-2-thione;propan-2-imine;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane-2-thione;propan-2-imine;propan-2-one?
The IUPAC name of propane-2-thione;propan-2-imine;propan-2-one (CID 160670260) is propane-2-thione;propan-2-imine;propan-2-one.
What is the SMILES notation for propane-2-thione;propan-2-imine;propan-2-one?
The canonical SMILES for propane-2-thione;propan-2-imine;propan-2-one is CC(C)=O.CC(C)=S.[H]N=C(C)C.
What is the InChIKey of propane-2-thione;propan-2-imine;propan-2-one?
The InChIKey is RMVKLKDFEBTRSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N.C3H6O.C3H6S/c3*1-3(2)4/h4H,1-2H3;2*1-2H3.
What are the key properties of propane-2-thione;propan-2-imine;propan-2-one?
propane-2-thione;propan-2-imine;propan-2-one has a molecular weight of 189.32 g/mol, XLogP of 3.04, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propane-2-thione;propan-2-imine;propan-2-one is sourced from PubChem (CID 160670260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).