About acetylene;propan-2-one
acetylene;propan-2-one (PubChem CID 175379090) has the molecular formula C7H10O
and a molecular weight of 110.16 g/mol. Its IUPAC name is acetylene;propan-2-one.
Molecular Properties
| Compound Name | acetylene;propan-2-one |
| PubChem CID | 175379090 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | acetylene;propan-2-one |
| SMILES | C#C.C#C.CC(C)=O |
| InChI | InChI=1S/C3H6O.2C2H2/c1-3(2)4;2*1-2/h1-2H3;2*1-2H |
| InChIKey | FDZDRXLQJBJAAD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;propan-2-one?
The IUPAC name of acetylene;propan-2-one (CID 175379090) is acetylene;propan-2-one.
What is the SMILES notation for acetylene;propan-2-one?
The canonical SMILES for acetylene;propan-2-one is C#C.C#C.CC(C)=O.
What is the InChIKey of acetylene;propan-2-one?
The InChIKey is FDZDRXLQJBJAAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.2C2H2/c1-3(2)4;2*1-2/h1-2H3;2*1-2H.
What are the key properties of acetylene;propan-2-one?
acetylene;propan-2-one has a molecular weight of 110.16 g/mol, XLogP of 1.09, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;propan-2-one is sourced from PubChem (CID 175379090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).