About chromium(6+);tris(oxygen(2-));propan-2-one
chromium(6+);tris(oxygen(2-));propan-2-one (PubChem CID 173410195) has the molecular formula C3H6CrO4
and a molecular weight of 158.07 g/mol. Its IUPAC name is chromium(6+);tris(oxygen(2-));propan-2-one.
Molecular Properties
| Compound Name | chromium(6+);tris(oxygen(2-));propan-2-one |
| PubChem CID | 173410195 |
| Molecular Formula | C3H6CrO4 |
| Molecular Weight | 158.07 g/mol |
| Exact Mass | 157.97 |
| IUPAC Name | chromium(6+);tris(oxygen(2-));propan-2-one |
| SMILES | CC(C)=O.[Cr+6].[O-2].[O-2].[O-2] |
| InChI | InChI=1S/C3H6O.Cr.3O/c1-3(2)4;;;;/h1-2H3;;;;/q;+6;3*-2 |
| InChIKey | YMZSXEXRMYOSLS-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 102.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.07 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze chromium(6+);tris(oxygen(2-));propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium(6+);tris(oxygen(2-));propan-2-one?
The IUPAC name of chromium(6+);tris(oxygen(2-));propan-2-one (CID 173410195) is chromium(6+);tris(oxygen(2-));propan-2-one.
What is the SMILES notation for chromium(6+);tris(oxygen(2-));propan-2-one?
The canonical SMILES for chromium(6+);tris(oxygen(2-));propan-2-one is CC(C)=O.[Cr+6].[O-2].[O-2].[O-2].
What is the InChIKey of chromium(6+);tris(oxygen(2-));propan-2-one?
The InChIKey is YMZSXEXRMYOSLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.Cr.3O/c1-3(2)4;;;;/h1-2H3;;;;/q;+6;3*-2.
What are the key properties of chromium(6+);tris(oxygen(2-));propan-2-one?
chromium(6+);tris(oxygen(2-));propan-2-one has a molecular weight of 158.07 g/mol, XLogP of 0.24, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chromium(6+);tris(oxygen(2-));propan-2-one is sourced from PubChem (CID 173410195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).