About methanol;propan-2-one;dihydrate
methanol;propan-2-one;dihydrate (PubChem CID 158013024) has the molecular formula C4H14O4
and a molecular weight of 126.15 g/mol. Its IUPAC name is methanol;propan-2-one;dihydrate.
Molecular Properties
| Compound Name | methanol;propan-2-one;dihydrate |
| PubChem CID | 158013024 |
| Molecular Formula | C4H14O4 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | methanol;propan-2-one;dihydrate |
| SMILES | CC(C)=O.CO.O.O |
| InChI | InChI=1S/C3H6O.CH4O.2H2O/c1-3(2)4;1-2;;/h1-2H3;2H,1H3;2*1H2 |
| InChIKey | FFCZFNYMEAGECS-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 100.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methanol;propan-2-one;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;propan-2-one;dihydrate?
The IUPAC name of methanol;propan-2-one;dihydrate (CID 158013024) is methanol;propan-2-one;dihydrate.
What is the SMILES notation for methanol;propan-2-one;dihydrate?
The canonical SMILES for methanol;propan-2-one;dihydrate is CC(C)=O.CO.O.O.
What is the InChIKey of methanol;propan-2-one;dihydrate?
The InChIKey is FFCZFNYMEAGECS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.CH4O.2H2O/c1-3(2)4;1-2;;/h1-2H3;2H,1H3;2*1H2.
What are the key properties of methanol;propan-2-one;dihydrate?
methanol;propan-2-one;dihydrate has a molecular weight of 126.15 g/mol, XLogP of -1.45, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;propan-2-one;dihydrate is sourced from PubChem (CID 158013024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).