About hydrazine;propan-2-one;dihydrate
hydrazine;propan-2-one;dihydrate (PubChem CID 18407837) has the molecular formula C3H14N2O3
and a molecular weight of 126.16 g/mol. Its IUPAC name is hydrazine;propan-2-one;dihydrate.
Molecular Properties
| Compound Name | hydrazine;propan-2-one;dihydrate |
| PubChem CID | 18407837 |
| Molecular Formula | C3H14N2O3 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | hydrazine;propan-2-one;dihydrate |
| SMILES | CC(C)=O.NN.O.O |
| InChI | InChI=1S/C3H6O.H4N2.2H2O/c1-3(2)4;1-2;;/h1-2H3;1-2H2;2*1H2 |
| InChIKey | VBGLEIZRTPXNRE-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;propan-2-one;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;propan-2-one;dihydrate?
The IUPAC name of hydrazine;propan-2-one;dihydrate (CID 18407837) is hydrazine;propan-2-one;dihydrate.
What is the SMILES notation for hydrazine;propan-2-one;dihydrate?
The canonical SMILES for hydrazine;propan-2-one;dihydrate is CC(C)=O.NN.O.O.
What is the InChIKey of hydrazine;propan-2-one;dihydrate?
The InChIKey is VBGLEIZRTPXNRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.H4N2.2H2O/c1-3(2)4;1-2;;/h1-2H3;1-2H2;2*1H2.
What are the key properties of hydrazine;propan-2-one;dihydrate?
hydrazine;propan-2-one;dihydrate has a molecular weight of 126.16 g/mol, XLogP of -2.24, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;propan-2-one;dihydrate is sourced from PubChem (CID 18407837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).