About argon;propan-2-one
argon;propan-2-one (PubChem CID 19604749) has the molecular formula C3H6ArO
and a molecular weight of 98.03 g/mol. Its IUPAC name is argon;propan-2-one.
Molecular Properties
| Compound Name | argon;propan-2-one |
| PubChem CID | 19604749 |
| Molecular Formula | C3H6ArO |
| Molecular Weight | 98.03 g/mol |
| Exact Mass | 98.00 |
| IUPAC Name | argon;propan-2-one |
| SMILES | CC(C)=O.[Ar] |
| InChI | InChI=1S/C3H6O.Ar/c1-3(2)4;/h1-2H3; |
| InChIKey | WOMUXWWKRWRGIP-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.03 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze argon;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of argon;propan-2-one?
The IUPAC name of argon;propan-2-one (CID 19604749) is argon;propan-2-one.
What is the SMILES notation for argon;propan-2-one?
The canonical SMILES for argon;propan-2-one is CC(C)=O.[Ar].
What is the InChIKey of argon;propan-2-one?
The InChIKey is WOMUXWWKRWRGIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.Ar/c1-3(2)4;/h1-2H3;.
What are the key properties of argon;propan-2-one?
argon;propan-2-one has a molecular weight of 98.03 g/mol, XLogP of 0.60, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for argon;propan-2-one is sourced from PubChem (CID 19604749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).