About bis(sulfanylidene)molybdenum;propan-2-one
bis(sulfanylidene)molybdenum;propan-2-one (PubChem CID 174887622) has the molecular formula C3H6MoOS2
and a molecular weight of 218.15 g/mol. Its IUPAC name is bis(sulfanylidene)molybdenum;propan-2-one.
Molecular Properties
| Compound Name | bis(sulfanylidene)molybdenum;propan-2-one |
| PubChem CID | 174887622 |
| Molecular Formula | C3H6MoOS2 |
| Molecular Weight | 218.15 g/mol |
| Exact Mass | 219.89 |
| IUPAC Name | bis(sulfanylidene)molybdenum;propan-2-one |
| SMILES | CC(C)=O.S=[Mo]=S |
| InChI | InChI=1S/C3H6O.Mo.2S/c1-3(2)4;;;/h1-2H3;;; |
| InChIKey | GWQPINKWUKXSRM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.15 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(sulfanylidene)molybdenum;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(sulfanylidene)molybdenum;propan-2-one?
The IUPAC name of bis(sulfanylidene)molybdenum;propan-2-one (CID 174887622) is bis(sulfanylidene)molybdenum;propan-2-one.
What is the SMILES notation for bis(sulfanylidene)molybdenum;propan-2-one?
The canonical SMILES for bis(sulfanylidene)molybdenum;propan-2-one is CC(C)=O.S=[Mo]=S.
What is the InChIKey of bis(sulfanylidene)molybdenum;propan-2-one?
The InChIKey is GWQPINKWUKXSRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.Mo.2S/c1-3(2)4;;;/h1-2H3;;;.
What are the key properties of bis(sulfanylidene)molybdenum;propan-2-one?
bis(sulfanylidene)molybdenum;propan-2-one has a molecular weight of 218.15 g/mol, XLogP of 1.89, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(sulfanylidene)molybdenum;propan-2-one is sourced from PubChem (CID 174887622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).