About bromoform;propan-2-one
bromoform;propan-2-one (PubChem CID 174299446) has the molecular formula C4H7Br3O
and a molecular weight of 310.81 g/mol. Its IUPAC name is bromoform;propan-2-one.
Molecular Properties
| Compound Name | bromoform;propan-2-one |
| PubChem CID | 174299446 |
| Molecular Formula | C4H7Br3O |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 307.80 |
| IUPAC Name | bromoform;propan-2-one |
| SMILES | BrC(Br)Br.CC(C)=O |
| InChI | InChI=1S/C3H6O.CHBr3/c1-3(2)4;2-1(3)4/h1-2H3;1H |
| InChIKey | NZVLBVJPUVWQTE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bromoform;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromoform;propan-2-one?
The IUPAC name of bromoform;propan-2-one (CID 174299446) is bromoform;propan-2-one.
What is the SMILES notation for bromoform;propan-2-one?
The canonical SMILES for bromoform;propan-2-one is BrC(Br)Br.CC(C)=O.
What is the InChIKey of bromoform;propan-2-one?
The InChIKey is NZVLBVJPUVWQTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.CHBr3/c1-3(2)4;2-1(3)4/h1-2H3;1H.
What are the key properties of bromoform;propan-2-one?
bromoform;propan-2-one has a molecular weight of 310.81 g/mol, XLogP of 3.05, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromoform;propan-2-one is sourced from PubChem (CID 174299446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).