C4H4Br2O2 — CID 54234257
1,1-dibromobutane-2,3-dione (PubChem CID 54234257) has the molecular formula C4H4Br2O2 and a molecular weight of 243.88 g/mol. Its IUPAC name is 1,1-dibromobutane-2,3-dione.
| Compound Name | 1,1-dibromobutane-2,3-dione |
|---|---|
| PubChem CID | 54234257 |
| Molecular Formula | C4H4Br2O2 |
| Molecular Weight | 243.88 g/mol |
| Exact Mass | 241.86 |
| IUPAC Name | 1,1-dibromobutane-2,3-dione |
| SMILES | CC(=O)C(=O)C(Br)Br |
| InChI | InChI=1S/C4H4Br2O2/c1-2(7)3(8)4(5)6/h4H,1H3 |
| InChIKey | QLKFLGBHNAXDEO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.88 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|