C8H14O3 — CID 90904754
4-ethyl-5-hydroxyhexane-2,3-dione (PubChem CID 90904754) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is 4-ethyl-5-hydroxyhexane-2,3-dione.
| Compound Name | 4-ethyl-5-hydroxyhexane-2,3-dione |
|---|---|
| PubChem CID | 90904754 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 4-ethyl-5-hydroxyhexane-2,3-dione |
| SMILES | CCC(C(=O)C(C)=O)C(C)O |
| InChI | InChI=1S/C8H14O3/c1-4-7(5(2)9)8(11)6(3)10/h5,7,9H,4H2,1-3H3 |
| InChIKey | IAEJBGAKWQKHPM-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|