C6H10O4 — CID 57392938
(4S,5S)-4,5-dihydroxyhexane-2,3-dione (PubChem CID 57392938) has the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. Its IUPAC name is (4S,5S)-4,5-dihydroxyhexane-2,3-dione.
| Compound Name | (4S,5S)-4,5-dihydroxyhexane-2,3-dione |
|---|---|
| PubChem CID | 57392938 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | (4S,5S)-4,5-dihydroxyhexane-2,3-dione |
| SMILES | CC(=O)C(=O)[C@@H](O)[C@H](C)O |
| InChI | InChI=1S/C6H10O4/c1-3(7)5(9)6(10)4(2)8/h3,5,7,9H,1-2H3/t3-,5-/m0/s1 |
| InChIKey | AIPDLMFOMKZWOH-UCORVYFPSA-N |
| XLogP | -1.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|