C8H15NO5 — CID 87113894
(4R,5R,6S,7R)-4-amino-5,6,7-trihydroxyoctane-2,3-dione (PubChem CID 87113894) has the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. Its IUPAC name is (4R,5R,6S,7R)-4-amino-5,6,7-trihydroxyoctane-2,3-dione.
| Compound Name | (4R,5R,6S,7R)-4-amino-5,6,7-trihydroxyoctane-2,3-dione |
|---|---|
| PubChem CID | 87113894 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | (4R,5R,6S,7R)-4-amino-5,6,7-trihydroxyoctane-2,3-dione |
| SMILES | CC(=O)C(=O)[C@H](N)[C@@H](O)[C@@H](O)[C@@H](C)O |
| InChI | InChI=1S/C8H15NO5/c1-3(10)6(12)5(9)8(14)7(13)4(2)11/h4-5,7-8,11,13-14H,9H2,1-2H3/t4-,5+,7+,8-/m1/s1 |
| InChIKey | XSLSEIQXVSSOQL-HETMPLHPSA-N |
| XLogP | -2.43 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|