C7H15NO5 — CID 22797763
(3R,4R,5S,6R)-3-amino-4,5,6,7-tetrahydroxyheptan-2-one (PubChem CID 22797763) has the molecular formula C7H15NO5 and a molecular weight of 193.20 g/mol. Its IUPAC name is (3R,4R,5S,6R)-3-amino-4,5,6,7-tetrahydroxyheptan-2-one.
| Compound Name | (3R,4R,5S,6R)-3-amino-4,5,6,7-tetrahydroxyheptan-2-one |
|---|---|
| PubChem CID | 22797763 |
| Molecular Formula | C7H15NO5 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | (3R,4R,5S,6R)-3-amino-4,5,6,7-tetrahydroxyheptan-2-one |
| SMILES | CC(=O)[C@H](N)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H15NO5/c1-3(10)5(8)7(13)6(12)4(11)2-9/h4-7,9,11-13H,2,8H2,1H3/t4-,5+,6-,7-/m1/s1 |
| InChIKey | JXQZSKIYXHGYCP-XZBKPIIZSA-N |
| XLogP | -3.02 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |