C8H15NO6 — CID 22816133
(4R,5R,6R,7R)-4-amino-5,6,7,8-tetrahydroxyoctane-2,3-dione (PubChem CID 22816133) has the molecular formula C8H15NO6 and a molecular weight of 221.21 g/mol. Its IUPAC name is (4R,5R,6R,7R)-4-amino-5,6,7,8-tetrahydroxyoctane-2,3-dione.
| Compound Name | (4R,5R,6R,7R)-4-amino-5,6,7,8-tetrahydroxyoctane-2,3-dione |
|---|---|
| PubChem CID | 22816133 |
| Molecular Formula | C8H15NO6 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | (4R,5R,6R,7R)-4-amino-5,6,7,8-tetrahydroxyoctane-2,3-dione |
| SMILES | CC(=O)C(=O)[C@H](N)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H15NO6/c1-3(11)6(13)5(9)8(15)7(14)4(12)2-10/h4-5,7-8,10,12,14-15H,2,9H2,1H3/t4-,5+,7+,8-/m1/s1 |
| InChIKey | AIWBNMWVDUSXLC-HETMPLHPSA-N |
| XLogP | -3.45 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|