C12H19NO7 — CID 87428118
[(2R,3S,4R,5R)-5-amino-1,2,3-trihydroxy-6,7-dioxooctan-4-yl] 2-methylprop-2-enoate (PubChem CID 87428118) has the molecular formula C12H19NO7 and a molecular weight of 289.28 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-amino-1,2,3-trihydroxy-6,7-dioxooctan-4-yl] 2-methylprop-2-enoate.
| Compound Name | [(2R,3S,4R,5R)-5-amino-1,2,3-trihydroxy-6,7-dioxooctan-4-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87428118 |
| Molecular Formula | C12H19NO7 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | [(2R,3S,4R,5R)-5-amino-1,2,3-trihydroxy-6,7-dioxooctan-4-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[C@@H]([C@@H](O)[C@H](O)CO)[C@@H](N)C(=O)C(C)=O |
| InChI | InChI=1S/C12H19NO7/c1-5(2)12(19)20-11(10(18)7(16)4-14)8(13)9(17)6(3)15/h7-8,10-11,14,16,18H,1,4,13H2,2-3H3/t7-,8+,10+,11-/m1/s1 |
| InChIKey | IIDHFRQJSCMLHN-YKDSUIRESA-N |
| XLogP | -2.33 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|