C12H21NO11 — CID 91617241
[(2R,3R,4S,5R)-2-amino-4,5,6-trihydroxy-1-oxohexan-3-yl] (3S,4R,5S)-3,4,5,6-tetrahydroxy-2-oxohexanoate (PubChem CID 91617241) has the molecular formula C12H21NO11 and a molecular weight of 355.30 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-2-amino-4,5,6-trihydroxy-1-oxohexan-3-yl] (3S,4R,5S)-3,4,5,6-tetrahydroxy-2-oxohexanoate.
| Compound Name | [(2R,3R,4S,5R)-2-amino-4,5,6-trihydroxy-1-oxohexan-3-yl] (3S,4R,5S)-3,4,5,6-tetrahydroxy-2-oxohexanoate |
|---|---|
| PubChem CID | 91617241 |
| Molecular Formula | C12H21NO11 |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | [(2R,3R,4S,5R)-2-amino-4,5,6-trihydroxy-1-oxohexan-3-yl] (3S,4R,5S)-3,4,5,6-tetrahydroxy-2-oxohexanoate |
| SMILES | N[C@@H](C=O)[C@@H](OC(=O)C(=O)[C@@H](O)[C@H](O)[C@@H](O)CO)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H21NO11/c13-4(1-14)11(8(20)6(18)3-16)24-12(23)10(22)9(21)7(19)5(17)2-15/h1,4-9,11,15-21H,2-3,13H2/t4-,5-,6+,7+,8-,9-,11+/m0/s1 |
| InChIKey | IMFLUBKKBMCRHK-JQGBNNLQSA-N |
| XLogP | -6.22 |
| TPSA | 228.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | -6.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|