C11H20O12 — CID 160852759
3,4,5,6-tetrahydroxy-2-oxohexanoic acid;2,3,4,5-tetrahydroxypentanal (PubChem CID 160852759) has the molecular formula C11H20O12 and a molecular weight of 344.27 g/mol. Its IUPAC name is 3,4,5,6-tetrahydroxy-2-oxohexanoic acid;2,3,4,5-tetrahydroxypentanal.
| Compound Name | 3,4,5,6-tetrahydroxy-2-oxohexanoic acid;2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 160852759 |
| Molecular Formula | C11H20O12 |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 3,4,5,6-tetrahydroxy-2-oxohexanoic acid;2,3,4,5-tetrahydroxypentanal |
| SMILES | O=C(O)C(=O)C(O)C(O)C(O)CO.O=CC(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H10O7.C5H10O5/c7-1-2(8)3(9)4(10)5(11)6(12)13;6-1-3(8)5(10)4(9)2-7/h2-4,7-10H,1H2,(H,12,13);1,3-5,7-10H,2H2 |
| InChIKey | SJLYBBHHPGKDLD-UHFFFAOYSA-N |
| XLogP | -6.02 |
| TPSA | 233.28 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | -6.02 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|