C6H10NaO7 — CID 131879322
CID 131879322 (PubChem CID 131879322) has the molecular formula C6H10NaO7 and a molecular weight of 217.13 g/mol.
| Compound Name | CID 131879322 |
|---|---|
| PubChem CID | 131879322 |
| Molecular Formula | C6H10NaO7 |
| Molecular Weight | 217.13 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | — |
| SMILES | O=C(O)C(=O)[C@@H](O)[C@H](O)[C@@H](O)CO.[Na] |
| InChI | InChI=1S/C6H10O7.Na/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-4,7-10H,1H2,(H,12,13);/t2-,3+,4-;/m0./s1 |
| InChIKey | WGHORRXMHFGCFO-RROVWVHZSA-N |
| XLogP | -3.67 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.13 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|