C9H18O9 — CID 54572556
(2R,3R,4R,6R,7R,8S)-1,2,3,4,6,7,8,9-octahydroxynonan-5-one (PubChem CID 54572556) has the molecular formula C9H18O9 and a molecular weight of 270.23 g/mol. Its IUPAC name is (2R,3R,4R,6R,7R,8S)-1,2,3,4,6,7,8,9-octahydroxynonan-5-one.
| Compound Name | (2R,3R,4R,6R,7R,8S)-1,2,3,4,6,7,8,9-octahydroxynonan-5-one |
|---|---|
| PubChem CID | 54572556 |
| Molecular Formula | C9H18O9 |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (2R,3R,4R,6R,7R,8S)-1,2,3,4,6,7,8,9-octahydroxynonan-5-one |
| SMILES | O=C([C@H](O)[C@H](O)[C@H](O)CO)[C@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C9H18O9/c10-1-3(12)5(14)7(16)9(18)8(17)6(15)4(13)2-11/h3-8,10-17H,1-2H2/t3-,4+,5-,6-,7-,8-/m1/s1 |
| InChIKey | ZYINTGCCSRGTIW-XAZAIFFQSA-N |
| XLogP | -5.29 |
| TPSA | 178.91 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | -5.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |