C6H12O7 — CID 150795410
(3S,4R,5R)-1,1,3,4,5,6-hexahydroxyhexan-2-one (PubChem CID 150795410) has the molecular formula C6H12O7 and a molecular weight of 196.16 g/mol. Its IUPAC name is (3S,4R,5R)-1,1,3,4,5,6-hexahydroxyhexan-2-one.
| Compound Name | (3S,4R,5R)-1,1,3,4,5,6-hexahydroxyhexan-2-one |
|---|---|
| PubChem CID | 150795410 |
| Molecular Formula | C6H12O7 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | (3S,4R,5R)-1,1,3,4,5,6-hexahydroxyhexan-2-one |
| SMILES | O=C(C(O)O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-4,6-10,12-13H,1H2/t2-,3-,4+/m1/s1 |
| InChIKey | KESPVIUMXXSGKL-JJYYJPOSSA-N |
| XLogP | -4.06 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | -4.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|